PRODUCTS
guoshun chemical
PRODUCTS
Isobutyraldehyde
Product name | Isobutyraldehyde |
English alias | sobutyraldehyde 2-Formylpropane |
CAS | 78-84-2 |
EINECS | 201-149-6 |
Chemical formula | C4H8O |
Molecular weight | 72.11 |
InChI | InChI=1/C4H8O/c1-4(2)3-5/h3-4H,1-2H3 |
Density | 0.79 g/mL at 25 °C (lit.) |
Melting point | -65 °C (lit.) |
Boiling point | 63 °C (lit.) |
Flash point | −40°F |
Physical and chemical properties | Colorless transparent high refractive liquid. It has a special strong pungent smell. Boiling point 64 ℃, melting point - 66 ℃, flash point - 40 ℃, refractive index (D20) 1.3730. It is miscible in ethanol, benzene, carbon disulfide, acetone, toluene, chloroform and ether, and slightly soluble in water (1:125). |
Use | Used for making rubber vulcanization accelerator, antioxidant, isobutyric acid, etc |